C10H10INO — CID 174273326
4-iodo-7-propan-2-yl-1,2-benzoxazole (PubChem CID 174273326) has the molecular formula C10H10INO and a molecular weight of 287.10 g/mol. Its IUPAC name is 4-iodo-7-propan-2-yl-1,2-benzoxazole.
| Compound Name | 4-iodo-7-propan-2-yl-1,2-benzoxazole |
|---|---|
| PubChem CID | 174273326 |
| Molecular Formula | C10H10INO |
| Molecular Weight | 287.10 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 4-iodo-7-propan-2-yl-1,2-benzoxazole |
| SMILES | CC(C)c1ccc(I)c2cnoc12 |
| InChI | InChI=1S/C10H10INO/c1-6(2)7-3-4-9(11)8-5-12-13-10(7)8/h3-6H,1-2H3 |
| InChIKey | YOZONHQYLVIWFZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.10 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|