C22H39N3O6 — CID 174273956
(11R)-11-hydroxy-11-methoxy-7,15-dimethyl-2-[2-[methyl(propan-2-yl)amino]acetyl]-5-oxa-2,15-diazaspiro[3.12]hexadecane-6,8-dione (PubChem CID 174273956) has the molecular formula C22H39N3O6 and a molecular weight of 441.57 g/mol. Its IUPAC name is (11R)-11-hydroxy-11-methoxy-7,15-dimethyl-2-[2-[methyl(propan-2-yl)amino]acetyl]-5-oxa-2,15-diazaspiro[3.12]hexadecane-6,8-dione.
| Compound Name | (11R)-11-hydroxy-11-methoxy-7,15-dimethyl-2-[2-[methyl(propan-2-yl)amino]acetyl]-5-oxa-2,15-diazaspiro[3.12]hexadecane-6,8-dione |
|---|---|
| PubChem CID | 174273956 |
| Molecular Formula | C22H39N3O6 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | (11R)-11-hydroxy-11-methoxy-7,15-dimethyl-2-[2-[methyl(propan-2-yl)amino]acetyl]-5-oxa-2,15-diazaspiro[3.12]hexadecane-6,8-dione |
| SMILES | CO[C@]1(O)CCCN(C)CC2(CN(C(=O)CN(C)C(C)C)C2)OC(=O)C(C)C(=O)CC1 |
| InChI | InChI=1S/C22H39N3O6/c1-16(2)24(5)12-19(27)25-14-21(15-25)13-23(4)11-7-9-22(29,30-6)10-8-18(26)17(3)20(28)31-21/h16-17,29H,7-15H2,1-6H3/t17?,22-/m1/s1 |
| InChIKey | VOJZWQIMPXXDMQ-IVAFLUGOSA-N |
| XLogP | 0.50 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|