C25H39N3O4 — CID 174273262
13-methoxy-9,17-dimethyl-3-(2-pyridin-3-ylethyl)-7-oxa-3,17-diazaspiro[5.12]octadecane-8,10-dione (PubChem CID 174273262) has the molecular formula C25H39N3O4 and a molecular weight of 445.60 g/mol. Its IUPAC name is 13-methoxy-9,17-dimethyl-3-(2-pyridin-3-ylethyl)-7-oxa-3,17-diazaspiro[5.12]octadecane-8,10-dione.
| Compound Name | 13-methoxy-9,17-dimethyl-3-(2-pyridin-3-ylethyl)-7-oxa-3,17-diazaspiro[5.12]octadecane-8,10-dione |
|---|---|
| PubChem CID | 174273262 |
| Molecular Formula | C25H39N3O4 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | 13-methoxy-9,17-dimethyl-3-(2-pyridin-3-ylethyl)-7-oxa-3,17-diazaspiro[5.12]octadecane-8,10-dione |
| SMILES | COC1CCCN(C)CC2(CCN(CCc3cccnc3)CC2)OC(=O)C(C)C(=O)CC1 |
| InChI | InChI=1S/C25H39N3O4/c1-20-23(29)9-8-22(31-3)7-5-14-27(2)19-25(32-24(20)30)11-16-28(17-12-25)15-10-21-6-4-13-26-18-21/h4,6,13,18,20,22H,5,7-12,14-17,19H2,1-3H3 |
| InChIKey | USHHZKWGSAZNBY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|