C13H18OS2 — CID 174278039
(8E)-8-prop-2-enylidene-3,4,5,7,9,10-hexahydro-2H-1,6-benzodithiocin-7-ol (PubChem CID 174278039) has the molecular formula C13H18OS2 and a molecular weight of 254.42 g/mol. Its IUPAC name is (8E)-8-prop-2-enylidene-3,4,5,7,9,10-hexahydro-2H-1,6-benzodithiocin-7-ol.
| Compound Name | (8E)-8-prop-2-enylidene-3,4,5,7,9,10-hexahydro-2H-1,6-benzodithiocin-7-ol |
|---|---|
| PubChem CID | 174278039 |
| Molecular Formula | C13H18OS2 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (8E)-8-prop-2-enylidene-3,4,5,7,9,10-hexahydro-2H-1,6-benzodithiocin-7-ol |
| SMILES | C=C/C=C1\CCC2=C(SCCCCS2)C1O |
| InChI | InChI=1S/C13H18OS2/c1-2-5-10-6-7-11-13(12(10)14)16-9-4-3-8-15-11/h2,5,12,14H,1,3-4,6-9H2/b10-5+ |
| InChIKey | AIGWKBBWFJLYFX-BJMVGYQFSA-N |
| XLogP | 3.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |