C10H14OS2 — CID 10465846
6-ethenyl-1,4-dithiaspiro[4.5]dec-6-en-8-ol (PubChem CID 10465846) has the molecular formula C10H14OS2 and a molecular weight of 214.35 g/mol. Its IUPAC name is 6-ethenyl-1,4-dithiaspiro[4.5]dec-6-en-8-ol.
| Compound Name | 6-ethenyl-1,4-dithiaspiro[4.5]dec-6-en-8-ol |
|---|---|
| PubChem CID | 10465846 |
| Molecular Formula | C10H14OS2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 6-ethenyl-1,4-dithiaspiro[4.5]dec-6-en-8-ol |
| SMILES | C=CC1=CC(O)CCC12SCCS2 |
| InChI | InChI=1S/C10H14OS2/c1-2-8-7-9(11)3-4-10(8)12-5-6-13-10/h2,7,9,11H,1,3-6H2 |
| InChIKey | RWBRDXLHVOCYFT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |