C11H16OS2 — CID 10537345
(9S)-11-ethenyl-1,5-dithiaspiro[5.5]undec-10-en-9-ol (PubChem CID 10537345) has the molecular formula C11H16OS2 and a molecular weight of 228.38 g/mol. Its IUPAC name is (9S)-11-ethenyl-1,5-dithiaspiro[5.5]undec-10-en-9-ol.
| Compound Name | (9S)-11-ethenyl-1,5-dithiaspiro[5.5]undec-10-en-9-ol |
|---|---|
| PubChem CID | 10537345 |
| Molecular Formula | C11H16OS2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (9S)-11-ethenyl-1,5-dithiaspiro[5.5]undec-10-en-9-ol |
| SMILES | C=CC1=C[C@@H](O)CCC12SCCCS2 |
| InChI | InChI=1S/C11H16OS2/c1-2-9-8-10(12)4-5-11(9)13-6-3-7-14-11/h2,8,10,12H,1,3-7H2/t10-/m0/s1 |
| InChIKey | MJDKTASXQKABRR-JTQLQIEISA-N |
| XLogP | 2.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |