C9H12OS2 — CID 11229419
4-(1,3-dithiolan-2-yl)cyclohexa-2,4-dien-1-ol (PubChem CID 11229419) has the molecular formula C9H12OS2 and a molecular weight of 200.33 g/mol. Its IUPAC name is 4-(1,3-dithiolan-2-yl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 4-(1,3-dithiolan-2-yl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 11229419 |
| Molecular Formula | C9H12OS2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 4-(1,3-dithiolan-2-yl)cyclohexa-2,4-dien-1-ol |
| SMILES | OC1C=CC(C2SCCS2)=CC1 |
| InChI | InChI=1S/C9H12OS2/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1-3,8-10H,4-6H2 |
| InChIKey | JCVPKNRRXQSYBI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |