C17H20N2O3S3 — CID 17427828
4-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]-1-thiophen-2-ylbutan-1-one (PubChem CID 17427828) has the molecular formula C17H20N2O3S3 and a molecular weight of 396.56 g/mol. Its IUPAC name is 4-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 17427828 |
| Molecular Formula | C17H20N2O3S3 |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]-1-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCSc1ccc(S(=O)(=O)N2CCCC2)cn1)c1cccs1 |
| InChI | InChI=1S/C17H20N2O3S3/c20-15(16-6-4-11-23-16)5-3-12-24-17-8-7-14(13-18-17)25(21,22)19-9-1-2-10-19/h4,6-8,11,13H,1-3,5,9-10,12H2 |
| InChIKey | JINRCDFLUBLQIP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|