About 3-(3-methoxyimidazo[4,5-b]pyridin-2-yl)pyridin-2-amine
3-(3-methoxyimidazo[4,5-b]pyridin-2-yl)pyridin-2-amine (PubChem CID 174278837) has the molecular formula C12H11N5O
and a molecular weight of 241.25 g/mol. Its IUPAC name is 3-(3-methoxyimidazo[4,5-b]pyridin-2-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-(3-methoxyimidazo[4,5-b]pyridin-2-yl)pyridin-2-amine |
| PubChem CID | 174278837 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 3-(3-methoxyimidazo[4,5-b]pyridin-2-yl)pyridin-2-amine |
| SMILES | COn1c(-c2cccnc2N)nc2cccnc21 |
| InChI | InChI=1S/C12H11N5O/c1-18-17-11(8-4-2-6-14-10(8)13)16-9-5-3-7-15-12(9)17/h2-7H,1H3,(H2,13,14) |
| InChIKey | BRMJLHNHLZWFMZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3-methoxyimidazo[4,5-b]pyridin-2-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methoxyimidazo[4,5-b]pyridin-2-yl)pyridin-2-amine?
The IUPAC name of 3-(3-methoxyimidazo[4,5-b]pyridin-2-yl)pyridin-2-amine (CID 174278837) is 3-(3-methoxyimidazo[4,5-b]pyridin-2-yl)pyridin-2-amine.
What is the SMILES notation for 3-(3-methoxyimidazo[4,5-b]pyridin-2-yl)pyridin-2-amine?
The canonical SMILES for 3-(3-methoxyimidazo[4,5-b]pyridin-2-yl)pyridin-2-amine is COn1c(-c2cccnc2N)nc2cccnc21.
What is the InChIKey of 3-(3-methoxyimidazo[4,5-b]pyridin-2-yl)pyridin-2-amine?
The InChIKey is BRMJLHNHLZWFMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5O/c1-18-17-11(8-4-2-6-14-10(8)13)16-9-5-3-7-15-12(9)17/h2-7H,1H3,(H2,13,14).
What are the key properties of 3-(3-methoxyimidazo[4,5-b]pyridin-2-yl)pyridin-2-amine?
3-(3-methoxyimidazo[4,5-b]pyridin-2-yl)pyridin-2-amine has a molecular weight of 241.25 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxyimidazo[4,5-b]pyridin-2-yl)pyridin-2-amine is sourced from PubChem (CID 174278837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).