C22H27N7O2Si — CID 174281020
3-[3-[tert-butyl(dimethyl)silyl]oxy-5-(5-methoxypyrimidin-2-yl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine (PubChem CID 174281020) has the molecular formula C22H27N7O2Si and a molecular weight of 449.59 g/mol. Its IUPAC name is 3-[3-[tert-butyl(dimethyl)silyl]oxy-5-(5-methoxypyrimidin-2-yl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine.
| Compound Name | 3-[3-[tert-butyl(dimethyl)silyl]oxy-5-(5-methoxypyrimidin-2-yl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 174281020 |
| Molecular Formula | C22H27N7O2Si |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 3-[3-[tert-butyl(dimethyl)silyl]oxy-5-(5-methoxypyrimidin-2-yl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
| SMILES | COc1cnc(-c2ccc3nc(-c4cccnc4N)n(O[Si](C)(C)C(C)(C)C)c3n2)nc1 |
| InChI | InChI=1S/C22H27N7O2Si/c1-22(2,3)32(5,6)31-29-20(15-8-7-11-24-18(15)23)28-17-10-9-16(27-21(17)29)19-25-12-14(30-4)13-26-19/h7-13H,1-6H3,(H2,23,24) |
| InChIKey | KSMOZGVLNCJNSW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|