C16H20N2O4 — CID 174282447
2-[(2-isocyanato-4-methylpentanoyl)amino]-3-phenylpropanoic acid (PubChem CID 174282447) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[(2-isocyanato-4-methylpentanoyl)amino]-3-phenylpropanoic acid.
| Compound Name | 2-[(2-isocyanato-4-methylpentanoyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 174282447 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-[(2-isocyanato-4-methylpentanoyl)amino]-3-phenylpropanoic acid |
| SMILES | CC(C)CC(N=C=O)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H20N2O4/c1-11(2)8-13(17-10-19)15(20)18-14(16(21)22)9-12-6-4-3-5-7-12/h3-7,11,13-14H,8-9H2,1-2H3,(H,18,20)(H,21,22) |
| InChIKey | CBBWNAVOROZQRP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|