C16H19NO2S — CID 174283058
(2S)-3-[[3-(3-sulfanylphenyl)phenyl]methylamino]propane-1,2-diol (PubChem CID 174283058) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is (2S)-3-[[3-(3-sulfanylphenyl)phenyl]methylamino]propane-1,2-diol.
| Compound Name | (2S)-3-[[3-(3-sulfanylphenyl)phenyl]methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 174283058 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | (2S)-3-[[3-(3-sulfanylphenyl)phenyl]methylamino]propane-1,2-diol |
| SMILES | OC[C@@H](O)CNCc1cccc(-c2cccc(S)c2)c1 |
| InChI | InChI=1S/C16H19NO2S/c18-11-15(19)10-17-9-12-3-1-4-13(7-12)14-5-2-6-16(20)8-14/h1-8,15,17-20H,9-11H2/t15-/m0/s1 |
| InChIKey | XFVFZFVYUZQXGA-HNNXBMFYSA-N |
| XLogP | 2.09 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|