C28H36N4O4 — CID 174286200
(1S,11R,15R,17S,21R)-15-amino-1,11,17,21-tetramethyl-7,8-dinitroso-4-oxopentacyclo[12.9.0.02,11.05,10.015,21]tricosa-2,5,7,9-tetraene-6-carboxamide (PubChem CID 174286200) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is (1S,11R,15R,17S,21R)-15-amino-1,11,17,21-tetramethyl-7,8-dinitroso-4-oxopentacyclo[12.9.0.02,11.05,10.015,21]tricosa-2,5,7,9-tetraene-6-carboxamide.
| Compound Name | (1S,11R,15R,17S,21R)-15-amino-1,11,17,21-tetramethyl-7,8-dinitroso-4-oxopentacyclo[12.9.0.02,11.05,10.015,21]tricosa-2,5,7,9-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 174286200 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (1S,11R,15R,17S,21R)-15-amino-1,11,17,21-tetramethyl-7,8-dinitroso-4-oxopentacyclo[12.9.0.02,11.05,10.015,21]tricosa-2,5,7,9-tetraene-6-carboxamide |
| SMILES | C[C@H]1CCC[C@]2(C)CC[C@]3(C)C4=CC(=O)c5c(cc(N=O)c(N=O)c5C(N)=O)[C@]4(C)CCC3[C@]2(N)C1 |
| InChI | InChI=1S/C28H36N4O4/c1-15-6-5-8-25(2)10-11-27(4)19(28(25,30)14-15)7-9-26(3)16-12-17(31-35)23(32-36)22(24(29)34)21(16)18(33)13-20(26)27/h12-13,15,19H,5-11,14,30H2,1-4H3,(H2,29,34)/t15-,19?,25+,26-,27-,28+/m0/s1 |
| InChIKey | IAXJLOBEIPEBFC-ZMWPKDKRSA-N |
| XLogP | 6.09 |
| TPSA | 145.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |