C15H30N2O5 — CID 174287270
N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3-(2-methylpropylamino)-4-oxopentanamide (PubChem CID 174287270) has the molecular formula C15H30N2O5 and a molecular weight of 318.41 g/mol. Its IUPAC name is N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3-(2-methylpropylamino)-4-oxopentanamide.
| Compound Name | N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3-(2-methylpropylamino)-4-oxopentanamide |
|---|---|
| PubChem CID | 174287270 |
| Molecular Formula | C15H30N2O5 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3-(2-methylpropylamino)-4-oxopentanamide |
| SMILES | CC(=O)C(CC(=O)NCCOCCOCCO)NCC(C)C |
| InChI | InChI=1S/C15H30N2O5/c1-12(2)11-17-14(13(3)19)10-15(20)16-4-6-21-8-9-22-7-5-18/h12,14,17-18H,4-11H2,1-3H3,(H,16,20) |
| InChIKey | YEVKILCQGKMJFX-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|