C16H30N4O3S — CID 174292103
4-(2,2-dimorpholin-4-ylthiomorpholin-3-yl)morpholine (PubChem CID 174292103) has the molecular formula C16H30N4O3S and a molecular weight of 358.51 g/mol. Its IUPAC name is 4-(2,2-dimorpholin-4-ylthiomorpholin-3-yl)morpholine.
| Compound Name | 4-(2,2-dimorpholin-4-ylthiomorpholin-3-yl)morpholine |
|---|---|
| PubChem CID | 174292103 |
| Molecular Formula | C16H30N4O3S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 4-(2,2-dimorpholin-4-ylthiomorpholin-3-yl)morpholine |
| SMILES | C1CSC(N2CCOCC2)(N2CCOCC2)C(N2CCOCC2)N1 |
| InChI | InChI=1S/C16H30N4O3S/c1-14-24-16(19-4-10-22-11-5-19,20-6-12-23-13-7-20)15(17-1)18-2-8-21-9-3-18/h15,17H,1-14H2 |
| InChIKey | LCZHNAHMMUODFB-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 49.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |