C6H13N3O — CID 173218441
3-imidazolidin-2-yl-1,3-oxazolidine (PubChem CID 173218441) has the molecular formula C6H13N3O and a molecular weight of 143.19 g/mol. Its IUPAC name is 3-imidazolidin-2-yl-1,3-oxazolidine.
| Compound Name | 3-imidazolidin-2-yl-1,3-oxazolidine |
|---|---|
| PubChem CID | 173218441 |
| Molecular Formula | C6H13N3O |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 3-imidazolidin-2-yl-1,3-oxazolidine |
| SMILES | C1CNC(N2CCOC2)N1 |
| InChI | InChI=1S/C6H13N3O/c1-2-8-6(7-1)9-3-4-10-5-9/h6-8H,1-5H2 |
| InChIKey | XCWWNBAINBIUHY-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |