C23H27BrO3 — CID 174292201
5-bromo-6-[2-(2-cyclopropylcyclopropyl)propyl]-4-hydroxy-3-(1-phenylpropyl)pyran-2-one (PubChem CID 174292201) has the molecular formula C23H27BrO3 and a molecular weight of 431.37 g/mol. Its IUPAC name is 5-bromo-6-[2-(2-cyclopropylcyclopropyl)propyl]-4-hydroxy-3-(1-phenylpropyl)pyran-2-one.
| Compound Name | 5-bromo-6-[2-(2-cyclopropylcyclopropyl)propyl]-4-hydroxy-3-(1-phenylpropyl)pyran-2-one |
|---|---|
| PubChem CID | 174292201 |
| Molecular Formula | C23H27BrO3 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 5-bromo-6-[2-(2-cyclopropylcyclopropyl)propyl]-4-hydroxy-3-(1-phenylpropyl)pyran-2-one |
| SMILES | CCC(c1ccccc1)c1c(O)c(Br)c(CC(C)C2CC2C2CC2)oc1=O |
| InChI | InChI=1S/C23H27BrO3/c1-3-16(14-7-5-4-6-8-14)20-22(25)21(24)19(27-23(20)26)11-13(2)17-12-18(17)15-9-10-15/h4-8,13,15-18,25H,3,9-12H2,1-2H3 |
| InChIKey | ITJBBKKFLCZGHJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |