About CID 174297388
CID 174297388 (PubChem CID 174297388) has the molecular formula C4H8BF2N2O2
and a molecular weight of 164.93 g/mol.
Molecular Properties
| Compound Name | CID 174297388 |
| PubChem CID | 174297388 |
| Molecular Formula | C4H8BF2N2O2 |
| Molecular Weight | 164.93 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | — |
| SMILES | CON=C(C)C=NO.F[B]F |
| InChI | InChI=1S/C4H8N2O2.BF2/c1-4(3-5-7)6-8-2;2-1-3/h3,7H,1-2H3; |
| InChIKey | IVAKXRSQIRILQO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.93 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 174297388 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174297388?
The IUPAC name of CID 174297388 (CID 174297388) is not available.
What is the SMILES notation for CID 174297388?
The canonical SMILES for CID 174297388 is CON=C(C)C=NO.F[B]F.
What is the InChIKey of CID 174297388?
The InChIKey is IVAKXRSQIRILQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O2.BF2/c1-4(3-5-7)6-8-2;2-1-3/h3,7H,1-2H3;.
What are the key properties of CID 174297388?
CID 174297388 has a molecular weight of 164.93 g/mol, XLogP of 0.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174297388 is sourced from PubChem (CID 174297388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).