About chromium;N-(2-methoxyiminopropylidene)hydroxylamine
chromium;N-(2-methoxyiminopropylidene)hydroxylamine (PubChem CID 174360652) has the molecular formula C4H8CrN2O2
and a molecular weight of 168.12 g/mol. Its IUPAC name is chromium;N-(2-methoxyiminopropylidene)hydroxylamine.
Molecular Properties
| Compound Name | chromium;N-(2-methoxyiminopropylidene)hydroxylamine |
| PubChem CID | 174360652 |
| Molecular Formula | C4H8CrN2O2 |
| Molecular Weight | 168.12 g/mol |
| Exact Mass | 168.00 |
| IUPAC Name | chromium;N-(2-methoxyiminopropylidene)hydroxylamine |
| SMILES | CON=C(C)C=NO.[Cr] |
| InChI | InChI=1S/C4H8N2O2.Cr/c1-4(3-5-7)6-8-2;/h3,7H,1-2H3; |
| InChIKey | FMCZLZAPDFPINP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.12 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze chromium;N-(2-methoxyiminopropylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;N-(2-methoxyiminopropylidene)hydroxylamine?
The IUPAC name of chromium;N-(2-methoxyiminopropylidene)hydroxylamine (CID 174360652) is chromium;N-(2-methoxyiminopropylidene)hydroxylamine.
What is the SMILES notation for chromium;N-(2-methoxyiminopropylidene)hydroxylamine?
The canonical SMILES for chromium;N-(2-methoxyiminopropylidene)hydroxylamine is CON=C(C)C=NO.[Cr].
What is the InChIKey of chromium;N-(2-methoxyiminopropylidene)hydroxylamine?
The InChIKey is FMCZLZAPDFPINP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O2.Cr/c1-4(3-5-7)6-8-2;/h3,7H,1-2H3;.
What are the key properties of chromium;N-(2-methoxyiminopropylidene)hydroxylamine?
chromium;N-(2-methoxyiminopropylidene)hydroxylamine has a molecular weight of 168.12 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;N-(2-methoxyiminopropylidene)hydroxylamine is sourced from PubChem (CID 174360652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).