C23H26Cl2N2O2 — CID 174298754
N-but-3-yn-2-yl-2-chloro-2-phenylacetamide;2-chloro-N-phenyl-N-propan-2-ylacetamide (PubChem CID 174298754) has the molecular formula C23H26Cl2N2O2 and a molecular weight of 433.38 g/mol. Its IUPAC name is N-but-3-yn-2-yl-2-chloro-2-phenylacetamide;2-chloro-N-phenyl-N-propan-2-ylacetamide.
| Compound Name | N-but-3-yn-2-yl-2-chloro-2-phenylacetamide;2-chloro-N-phenyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 174298754 |
| Molecular Formula | C23H26Cl2N2O2 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-but-3-yn-2-yl-2-chloro-2-phenylacetamide;2-chloro-N-phenyl-N-propan-2-ylacetamide |
| SMILES | C#CC(C)NC(=O)C(Cl)c1ccccc1.CC(C)N(C(=O)CCl)c1ccccc1 |
| InChI | InChI=1S/C12H12ClNO.C11H14ClNO/c1-3-9(2)14-12(15)11(13)10-7-5-4-6-8-10;1-9(2)13(11(14)8-12)10-6-4-3-5-7-10/h1,4-9,11H,2H3,(H,14,15);3-7,9H,8H2,1-2H3 |
| InChIKey | NQNZEMLMXLSPRI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|