About dichlorotitanium;N-propan-2-yl-N-(1-propoxyethyl)propan-2-amine
dichlorotitanium;N-propan-2-yl-N-(1-propoxyethyl)propan-2-amine (PubChem CID 174305097) has the molecular formula C11H25Cl2NOTi
and a molecular weight of 306.10 g/mol. Its IUPAC name is dichlorotitanium;N-propan-2-yl-N-(1-propoxyethyl)propan-2-amine.
Molecular Properties
| Compound Name | dichlorotitanium;N-propan-2-yl-N-(1-propoxyethyl)propan-2-amine |
| PubChem CID | 174305097 |
| Molecular Formula | C11H25Cl2NOTi |
| Molecular Weight | 306.10 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | dichlorotitanium;N-propan-2-yl-N-(1-propoxyethyl)propan-2-amine |
| SMILES | CCCOC(C)N(C(C)C)C(C)C.Cl[Ti]Cl |
| InChI | InChI=1S/C11H25NO.2ClH.Ti/c1-7-8-13-11(6)12(9(2)3)10(4)5;;;/h9-11H,7-8H2,1-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | UDJCLNLPNAQEGF-UHFFFAOYSA-L |
| XLogP | 4.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.10 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dichlorotitanium;N-propan-2-yl-N-(1-propoxyethyl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorotitanium;N-propan-2-yl-N-(1-propoxyethyl)propan-2-amine?
The IUPAC name of dichlorotitanium;N-propan-2-yl-N-(1-propoxyethyl)propan-2-amine (CID 174305097) is dichlorotitanium;N-propan-2-yl-N-(1-propoxyethyl)propan-2-amine.
What is the SMILES notation for dichlorotitanium;N-propan-2-yl-N-(1-propoxyethyl)propan-2-amine?
The canonical SMILES for dichlorotitanium;N-propan-2-yl-N-(1-propoxyethyl)propan-2-amine is CCCOC(C)N(C(C)C)C(C)C.Cl[Ti]Cl.
What is the InChIKey of dichlorotitanium;N-propan-2-yl-N-(1-propoxyethyl)propan-2-amine?
The InChIKey is UDJCLNLPNAQEGF-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H25NO.2ClH.Ti/c1-7-8-13-11(6)12(9(2)3)10(4)5;;;/h9-11H,7-8H2,1-6H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorotitanium;N-propan-2-yl-N-(1-propoxyethyl)propan-2-amine?
dichlorotitanium;N-propan-2-yl-N-(1-propoxyethyl)propan-2-amine has a molecular weight of 306.10 g/mol, XLogP of 4.25, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorotitanium;N-propan-2-yl-N-(1-propoxyethyl)propan-2-amine is sourced from PubChem (CID 174305097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).