About 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-hydroxyhexanedioic acid
2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-hydroxyhexanedioic acid (PubChem CID 174307354) has the molecular formula C12H23NO8
and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-hydroxyhexanedioic acid.
Analyze 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-hydroxyhexanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-hydroxyhexanedioic acid?
The IUPAC name of 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-hydroxyhexanedioic acid (CID 174307354) is 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-hydroxyhexanedioic acid.
What is the SMILES notation for 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-hydroxyhexanedioic acid?
The canonical SMILES for 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-hydroxyhexanedioic acid is CC(C)(CO)C(N)C(=O)O.O=C(O)CCCC(O)C(=O)O.
What is the InChIKey of 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-hydroxyhexanedioic acid?
The InChIKey is AYPCULNVNHKAOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3.C6H10O5/c1-6(2,3-8)4(7)5(9)10;7-4(6(10)11)2-1-3-5(8)9/h4,8H,3,7H2,1-2H3,(H,9,10);4,7H,1-3H2,(H,8,9)(H,10,11).
What are the key properties of 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-hydroxyhexanedioic acid?
2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-hydroxyhexanedioic acid has a molecular weight of 309.32 g/mol, XLogP of -0.90, 8 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-hydroxyhexanedioic acid is sourced from PubChem (CID 174307354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).