C17H27NS — CID 174307905
(3E,5E)-5-[(2-methylidenecyclohexyl)-methylsulfanylmethyl]octa-3,5,7-trien-3-amine (PubChem CID 174307905) has the molecular formula C17H27NS and a molecular weight of 277.48 g/mol. Its IUPAC name is (3E,5E)-5-[(2-methylidenecyclohexyl)-methylsulfanylmethyl]octa-3,5,7-trien-3-amine.
| Compound Name | (3E,5E)-5-[(2-methylidenecyclohexyl)-methylsulfanylmethyl]octa-3,5,7-trien-3-amine |
|---|---|
| PubChem CID | 174307905 |
| Molecular Formula | C17H27NS |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | (3E,5E)-5-[(2-methylidenecyclohexyl)-methylsulfanylmethyl]octa-3,5,7-trien-3-amine |
| SMILES | C=C/C=C(\C=C(\N)CC)C(SC)C1CCCCC1=C |
| InChI | InChI=1S/C17H27NS/c1-5-9-14(12-15(18)6-2)17(19-4)16-11-8-7-10-13(16)3/h5,9,12,16-17H,1,3,6-8,10-11,18H2,2,4H3/b14-9+,15-12+ |
| InChIKey | XRCJHHLXCZEDCJ-WKDANBKTSA-N |
| XLogP | 4.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|