C16H29NS — CID 118613545
(2Z,4Z)-5-methyl-6-(1-propylsulfanylpropyl)nona-2,4,8-trien-4-amine (PubChem CID 118613545) has the molecular formula C16H29NS and a molecular weight of 267.48 g/mol. Its IUPAC name is (2Z,4Z)-5-methyl-6-(1-propylsulfanylpropyl)nona-2,4,8-trien-4-amine.
| Compound Name | (2Z,4Z)-5-methyl-6-(1-propylsulfanylpropyl)nona-2,4,8-trien-4-amine |
|---|---|
| PubChem CID | 118613545 |
| Molecular Formula | C16H29NS |
| Molecular Weight | 267.48 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | (2Z,4Z)-5-methyl-6-(1-propylsulfanylpropyl)nona-2,4,8-trien-4-amine |
| SMILES | C=CCC(/C(C)=C(N)/C=C\C)C(CC)SCCC |
| InChI | InChI=1S/C16H29NS/c1-6-10-14(13(5)15(17)11-7-2)16(9-4)18-12-8-3/h6-7,11,14,16H,1,8-10,12,17H2,2-5H3/b11-7-,15-13- |
| InChIKey | NLTBKJVCGBVBCU-KFMOSWKXSA-N |
| XLogP | 4.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|