C19H31NO2 — CID 174312953
O-[(Z,4S)-9-(4-methylphenoxy)-4-propan-2-ylnon-2-en-2-yl]hydroxylamine (PubChem CID 174312953) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is O-[(Z,4S)-9-(4-methylphenoxy)-4-propan-2-ylnon-2-en-2-yl]hydroxylamine.
| Compound Name | O-[(Z,4S)-9-(4-methylphenoxy)-4-propan-2-ylnon-2-en-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 174312953 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | O-[(Z,4S)-9-(4-methylphenoxy)-4-propan-2-ylnon-2-en-2-yl]hydroxylamine |
| SMILES | C/C(=C/[C@@H](CCCCCOc1ccc(C)cc1)C(C)C)ON |
| InChI | InChI=1S/C19H31NO2/c1-15(2)18(14-17(4)22-20)8-6-5-7-13-21-19-11-9-16(3)10-12-19/h9-12,14-15,18H,5-8,13,20H2,1-4H3/b17-14-/t18-/m1/s1 |
| InChIKey | RDHPVLOUORJMSO-HGLWPWQMSA-N |
| XLogP | 5.00 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|