C27H41N2O3+ — CID 59582362
5-[4-[(2-amino-3-methylbutanoyl)oxy-(4-methylphenyl)methyl]phenoxy]pentyl-trimethylazanium (PubChem CID 59582362) has the molecular formula C27H41N2O3+ and a molecular weight of 441.64 g/mol. Its IUPAC name is 5-[4-[(2-amino-3-methylbutanoyl)oxy-(4-methylphenyl)methyl]phenoxy]pentyl-trimethylazanium.
| Compound Name | 5-[4-[(2-amino-3-methylbutanoyl)oxy-(4-methylphenyl)methyl]phenoxy]pentyl-trimethylazanium |
|---|---|
| PubChem CID | 59582362 |
| Molecular Formula | C27H41N2O3+ |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | 5-[4-[(2-amino-3-methylbutanoyl)oxy-(4-methylphenyl)methyl]phenoxy]pentyl-trimethylazanium |
| SMILES | Cc1ccc(C(OC(=O)C(N)C(C)C)c2ccc(OCCCCC[N+](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H41N2O3/c1-20(2)25(28)27(30)32-26(22-12-10-21(3)11-13-22)23-14-16-24(17-15-23)31-19-9-7-8-18-29(4,5)6/h10-17,20,25-26H,7-9,18-19,28H2,1-6H3/q+1 |
| InChIKey | LBGNRDUXGIROED-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|