C25H37N2O3+ — CID 59582322
5-[4-[2-aminopropanoyloxy-(4-methylphenyl)methyl]phenoxy]pentyl-trimethylazanium (PubChem CID 59582322) has the molecular formula C25H37N2O3+ and a molecular weight of 413.58 g/mol. Its IUPAC name is 5-[4-[2-aminopropanoyloxy-(4-methylphenyl)methyl]phenoxy]pentyl-trimethylazanium.
| Compound Name | 5-[4-[2-aminopropanoyloxy-(4-methylphenyl)methyl]phenoxy]pentyl-trimethylazanium |
|---|---|
| PubChem CID | 59582322 |
| Molecular Formula | C25H37N2O3+ |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | 5-[4-[2-aminopropanoyloxy-(4-methylphenyl)methyl]phenoxy]pentyl-trimethylazanium |
| SMILES | Cc1ccc(C(OC(=O)C(C)N)c2ccc(OCCCCC[N+](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H37N2O3/c1-19-9-11-21(12-10-19)24(30-25(28)20(2)26)22-13-15-23(16-14-22)29-18-8-6-7-17-27(3,4)5/h9-16,20,24H,6-8,17-18,26H2,1-5H3/q+1 |
| InChIKey | PIKHFJDPDVDPHI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|