C23H40N3O4+ — CID 70823713
4-[4-[2-[(2-amino-4-methylpentanoyl)amino]propanoyloxymethyl]phenoxy]butyl-trimethylazanium (PubChem CID 70823713) has the molecular formula C23H40N3O4+ and a molecular weight of 422.59 g/mol. Its IUPAC name is 4-[4-[2-[(2-amino-4-methylpentanoyl)amino]propanoyloxymethyl]phenoxy]butyl-trimethylazanium.
| Compound Name | 4-[4-[2-[(2-amino-4-methylpentanoyl)amino]propanoyloxymethyl]phenoxy]butyl-trimethylazanium |
|---|---|
| PubChem CID | 70823713 |
| Molecular Formula | C23H40N3O4+ |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | 4-[4-[2-[(2-amino-4-methylpentanoyl)amino]propanoyloxymethyl]phenoxy]butyl-trimethylazanium |
| SMILES | CC(C)CC(N)C(=O)NC(C)C(=O)OCc1ccc(OCCCC[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C23H39N3O4/c1-17(2)15-21(24)22(27)25-18(3)23(28)30-16-19-9-11-20(12-10-19)29-14-8-7-13-26(4,5)6/h9-12,17-18,21H,7-8,13-16,24H2,1-6H3/p+1 |
| InChIKey | XKGXFZPNFIRNPH-UHFFFAOYSA-O |
| XLogP | 2.47 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|