C22H26FN3O2 — CID 174319772
tert-butyl N-[2-[3-[1-amino-3-(4-fluorophenyl)iminoprop-1-en-2-yl]phenyl]ethyl]carbamate (PubChem CID 174319772) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[1-amino-3-(4-fluorophenyl)iminoprop-1-en-2-yl]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[1-amino-3-(4-fluorophenyl)iminoprop-1-en-2-yl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 174319772 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | tert-butyl N-[2-[3-[1-amino-3-(4-fluorophenyl)iminoprop-1-en-2-yl]phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1cccc(C(=CN)/C=N/c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H26FN3O2/c1-22(2,3)28-21(27)25-12-11-16-5-4-6-17(13-16)18(14-24)15-26-20-9-7-19(23)8-10-20/h4-10,13-15H,11-12,24H2,1-3H3,(H,25,27)/b18-14?,26-15+ |
| InChIKey | DMDCNTKFOMLDNX-RADDMKFVSA-N |
| XLogP | 4.59 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|