C14H21N3O5S — CID 22980950
amino-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]iminomethanesulfonic acid (PubChem CID 22980950) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is amino-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]iminomethanesulfonic acid.
| Compound Name | amino-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]iminomethanesulfonic acid |
|---|---|
| PubChem CID | 22980950 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | amino-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]iminomethanesulfonic acid |
| SMILES | CC(C)(C)OC(=O)NCCc1cccc(/N=C(\N)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C14H21N3O5S/c1-14(2,3)22-13(18)16-8-7-10-5-4-6-11(9-10)17-12(15)23(19,20)21/h4-6,9H,7-8H2,1-3H3,(H2,15,17)(H,16,18)(H,19,20,21) |
| InChIKey | OCPFRMAQRGCAKW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|