C15H14F3N7 — CID 174320017
2-[2-methanimidoyl-5-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]anilino]acetonitrile (PubChem CID 174320017) has the molecular formula C15H14F3N7 and a molecular weight of 349.32 g/mol. Its IUPAC name is 2-[2-methanimidoyl-5-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]anilino]acetonitrile.
| Compound Name | 2-[2-methanimidoyl-5-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]anilino]acetonitrile |
|---|---|
| PubChem CID | 174320017 |
| Molecular Formula | C15H14F3N7 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-[2-methanimidoyl-5-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]anilino]acetonitrile |
| SMILES | [H]/N=C/c1ccc(Nc2ncc(C(F)(F)F)c(NC)n2)cc1NCC#N |
| InChI | InChI=1S/C15H14F3N7/c1-21-13-11(15(16,17)18)8-23-14(25-13)24-10-3-2-9(7-20)12(6-10)22-5-4-19/h2-3,6-8,20,22H,5H2,1H3,(H2,21,23,24,25)/b20-7+ |
| InChIKey | ATCSSUAPBSTHPH-IFRROFPPSA-N |
| XLogP | 3.21 |
| TPSA | 109.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|