About 2-tert-butylphenol;1-methylsulfanylbutane
2-tert-butylphenol;1-methylsulfanylbutane (PubChem CID 174325017) has the molecular formula C15H26OS
and a molecular weight of 254.44 g/mol. Its IUPAC name is 2-tert-butylphenol;1-methylsulfanylbutane.
Molecular Properties
| Compound Name | 2-tert-butylphenol;1-methylsulfanylbutane |
| PubChem CID | 174325017 |
| Molecular Formula | C15H26OS |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 2-tert-butylphenol;1-methylsulfanylbutane |
| SMILES | CC(C)(C)c1ccccc1O.CCCCSC |
| InChI | InChI=1S/C10H14O.C5H12S/c1-10(2,3)8-6-4-5-7-9(8)11;1-3-4-5-6-2/h4-7,11H,1-3H3;3-5H2,1-2H3 |
| InChIKey | KXASFGPHURVLCY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butylphenol;1-methylsulfanylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylphenol;1-methylsulfanylbutane?
The IUPAC name of 2-tert-butylphenol;1-methylsulfanylbutane (CID 174325017) is 2-tert-butylphenol;1-methylsulfanylbutane.
What is the SMILES notation for 2-tert-butylphenol;1-methylsulfanylbutane?
The canonical SMILES for 2-tert-butylphenol;1-methylsulfanylbutane is CC(C)(C)c1ccccc1O.CCCCSC.
What is the InChIKey of 2-tert-butylphenol;1-methylsulfanylbutane?
The InChIKey is KXASFGPHURVLCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C5H12S/c1-10(2,3)8-6-4-5-7-9(8)11;1-3-4-5-6-2/h4-7,11H,1-3H3;3-5H2,1-2H3.
What are the key properties of 2-tert-butylphenol;1-methylsulfanylbutane?
2-tert-butylphenol;1-methylsulfanylbutane has a molecular weight of 254.44 g/mol, XLogP of 4.84, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylphenol;1-methylsulfanylbutane is sourced from PubChem (CID 174325017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).