C18H15F3N4O3 — CID 174327888
1-[4-(3-methoxyphenyl)-1-methyl-2-oxo-1,8-naphthyridin-3-yl]-1-(trifluoromethyl)urea (PubChem CID 174327888) has the molecular formula C18H15F3N4O3 and a molecular weight of 392.34 g/mol. Its IUPAC name is 1-[4-(3-methoxyphenyl)-1-methyl-2-oxo-1,8-naphthyridin-3-yl]-1-(trifluoromethyl)urea.
| Compound Name | 1-[4-(3-methoxyphenyl)-1-methyl-2-oxo-1,8-naphthyridin-3-yl]-1-(trifluoromethyl)urea |
|---|---|
| PubChem CID | 174327888 |
| Molecular Formula | C18H15F3N4O3 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 1-[4-(3-methoxyphenyl)-1-methyl-2-oxo-1,8-naphthyridin-3-yl]-1-(trifluoromethyl)urea |
| SMILES | COc1cccc(-c2c(N(C(N)=O)C(F)(F)F)c(=O)n(C)c3ncccc23)c1 |
| InChI | InChI=1S/C18H15F3N4O3/c1-24-15-12(7-4-8-23-15)13(10-5-3-6-11(9-10)28-2)14(16(24)26)25(17(22)27)18(19,20)21/h3-9H,1-2H3,(H2,22,27) |
| InChIKey | MWVCSHNJJLGZSE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|