C22H23N3O6 — CID 10310098
3-[3-[3-(methoxycarbonylamino)-1-methyl-2-oxo-1,8-naphthyridin-4-yl]phenoxy]propyl acetate (PubChem CID 10310098) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is 3-[3-[3-(methoxycarbonylamino)-1-methyl-2-oxo-1,8-naphthyridin-4-yl]phenoxy]propyl acetate.
| Compound Name | 3-[3-[3-(methoxycarbonylamino)-1-methyl-2-oxo-1,8-naphthyridin-4-yl]phenoxy]propyl acetate |
|---|---|
| PubChem CID | 10310098 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 3-[3-[3-(methoxycarbonylamino)-1-methyl-2-oxo-1,8-naphthyridin-4-yl]phenoxy]propyl acetate |
| SMILES | COC(=O)Nc1c(-c2cccc(OCCCOC(C)=O)c2)c2cccnc2n(C)c1=O |
| InChI | InChI=1S/C22H23N3O6/c1-14(26)30-11-6-12-31-16-8-4-7-15(13-16)18-17-9-5-10-23-20(17)25(2)21(27)19(18)24-22(28)29-3/h4-5,7-10,13H,6,11-12H2,1-3H3,(H,24,28) |
| InChIKey | JXGNPBQTVSPRFZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|