C34H31N3O6 — CID 139948186
3-[3-[2-oxo-3-(phenoxycarbonylamino)-1-propyl-1,8-naphthyridin-4-yl]phenoxy]propyl benzoate (PubChem CID 139948186) has the molecular formula C34H31N3O6 and a molecular weight of 577.64 g/mol. Its IUPAC name is 3-[3-[2-oxo-3-(phenoxycarbonylamino)-1-propyl-1,8-naphthyridin-4-yl]phenoxy]propyl benzoate.
| Compound Name | 3-[3-[2-oxo-3-(phenoxycarbonylamino)-1-propyl-1,8-naphthyridin-4-yl]phenoxy]propyl benzoate |
|---|---|
| PubChem CID | 139948186 |
| Molecular Formula | C34H31N3O6 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 3-[3-[2-oxo-3-(phenoxycarbonylamino)-1-propyl-1,8-naphthyridin-4-yl]phenoxy]propyl benzoate |
| SMILES | CCCn1c(=O)c(NC(=O)Oc2ccccc2)c(-c2cccc(OCCCOC(=O)c3ccccc3)c2)c2cccnc21 |
| InChI | InChI=1S/C34H31N3O6/c1-2-20-37-31-28(18-10-19-35-31)29(30(32(37)38)36-34(40)43-26-15-7-4-8-16-26)25-14-9-17-27(23-25)41-21-11-22-42-33(39)24-12-5-3-6-13-24/h3-10,12-19,23H,2,11,20-22H2,1H3,(H,36,40) |
| InChIKey | OVXKYOBPLQYSBP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|