C30H31N3O6 — CID 139948244
3-[3-[2-oxo-3-(phenoxycarbonylamino)-1-propyl-1,8-naphthyridin-4-yl]phenoxy]propyl propanoate (PubChem CID 139948244) has the molecular formula C30H31N3O6 and a molecular weight of 529.59 g/mol. Its IUPAC name is 3-[3-[2-oxo-3-(phenoxycarbonylamino)-1-propyl-1,8-naphthyridin-4-yl]phenoxy]propyl propanoate.
| Compound Name | 3-[3-[2-oxo-3-(phenoxycarbonylamino)-1-propyl-1,8-naphthyridin-4-yl]phenoxy]propyl propanoate |
|---|---|
| PubChem CID | 139948244 |
| Molecular Formula | C30H31N3O6 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | 3-[3-[2-oxo-3-(phenoxycarbonylamino)-1-propyl-1,8-naphthyridin-4-yl]phenoxy]propyl propanoate |
| SMILES | CCCn1c(=O)c(NC(=O)Oc2ccccc2)c(-c2cccc(OCCCOC(=O)CC)c2)c2cccnc21 |
| InChI | InChI=1S/C30H31N3O6/c1-3-17-33-28-24(15-9-16-31-28)26(27(29(33)35)32-30(36)39-22-12-6-5-7-13-22)21-11-8-14-23(20-21)37-18-10-19-38-25(34)4-2/h5-9,11-16,20H,3-4,10,17-19H2,1-2H3,(H,32,36) |
| InChIKey | RKHCTDQPLDFBGD-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|