C28H35N3O6 — CID 139948248
3-[3-[1-ethyl-2-oxo-3-(propan-2-yloxycarbonylamino)-1,8-naphthyridin-4-yl]phenoxy]propyl 2,2-dimethylpropanoate (PubChem CID 139948248) has the molecular formula C28H35N3O6 and a molecular weight of 509.60 g/mol. Its IUPAC name is 3-[3-[1-ethyl-2-oxo-3-(propan-2-yloxycarbonylamino)-1,8-naphthyridin-4-yl]phenoxy]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[3-[1-ethyl-2-oxo-3-(propan-2-yloxycarbonylamino)-1,8-naphthyridin-4-yl]phenoxy]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 139948248 |
| Molecular Formula | C28H35N3O6 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 3-[3-[1-ethyl-2-oxo-3-(propan-2-yloxycarbonylamino)-1,8-naphthyridin-4-yl]phenoxy]propyl 2,2-dimethylpropanoate |
| SMILES | CCn1c(=O)c(NC(=O)OC(C)C)c(-c2cccc(OCCCOC(=O)C(C)(C)C)c2)c2cccnc21 |
| InChI | InChI=1S/C28H35N3O6/c1-7-31-24-21(13-9-14-29-24)22(23(25(31)32)30-27(34)37-18(2)3)19-11-8-12-20(17-19)35-15-10-16-36-26(33)28(4,5)6/h8-9,11-14,17-18H,7,10,15-16H2,1-6H3,(H,30,34) |
| InChIKey | YZPBYQNJDLIIPU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|