C34H40N4O4 — CID 22105959
1-[2,6-di(propan-2-yl)phenyl]-3-[4-[3-(2-hydroxyethoxy)phenyl]-2-oxo-1-pent-4-enyl-1,8-naphthyridin-3-yl]urea (PubChem CID 22105959) has the molecular formula C34H40N4O4 and a molecular weight of 568.72 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[4-[3-(2-hydroxyethoxy)phenyl]-2-oxo-1-pent-4-enyl-1,8-naphthyridin-3-yl]urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[4-[3-(2-hydroxyethoxy)phenyl]-2-oxo-1-pent-4-enyl-1,8-naphthyridin-3-yl]urea |
|---|---|
| PubChem CID | 22105959 |
| Molecular Formula | C34H40N4O4 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[4-[3-(2-hydroxyethoxy)phenyl]-2-oxo-1-pent-4-enyl-1,8-naphthyridin-3-yl]urea |
| SMILES | C=CCCCn1c(=O)c(NC(=O)Nc2c(C(C)C)cccc2C(C)C)c(-c2cccc(OCCO)c2)c2cccnc21 |
| InChI | InChI=1S/C34H40N4O4/c1-6-7-8-18-38-32-28(16-11-17-35-32)29(24-12-9-13-25(21-24)42-20-19-39)31(33(38)40)37-34(41)36-30-26(22(2)3)14-10-15-27(30)23(4)5/h6,9-17,21-23,39H,1,7-8,18-20H2,2-5H3,(H2,36,37,41) |
| InChIKey | XHRFVLXUCNEHKN-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|