C37H39N5O3 — CID 22105984
1-[1-but-3-enyl-2-oxo-4-[3-(pyridin-3-ylmethoxy)phenyl]-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 22105984) has the molecular formula C37H39N5O3 and a molecular weight of 601.75 g/mol. Its IUPAC name is 1-[1-but-3-enyl-2-oxo-4-[3-(pyridin-3-ylmethoxy)phenyl]-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[1-but-3-enyl-2-oxo-4-[3-(pyridin-3-ylmethoxy)phenyl]-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 22105984 |
| Molecular Formula | C37H39N5O3 |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.31 |
| IUPAC Name | 1-[1-but-3-enyl-2-oxo-4-[3-(pyridin-3-ylmethoxy)phenyl]-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | C=CCCn1c(=O)c(NC(=O)Nc2c(C(C)C)cccc2C(C)C)c(-c2cccc(OCc3cccnc3)c2)c2cccnc21 |
| InChI | InChI=1S/C37H39N5O3/c1-6-7-20-42-35-31(17-11-19-39-35)32(27-13-8-14-28(21-27)45-23-26-12-10-18-38-22-26)34(36(42)43)41-37(44)40-33-29(24(2)3)15-9-16-30(33)25(4)5/h6,8-19,21-22,24-25H,1,7,20,23H2,2-5H3,(H2,40,41,44) |
| InChIKey | JKLCPMRCAOHVLR-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|