C31H34N4O3 — CID 139946757
1-[1-but-3-enyl-4-(3-hydroxyphenyl)-2-oxo-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 139946757) has the molecular formula C31H34N4O3 and a molecular weight of 510.64 g/mol. Its IUPAC name is 1-[1-but-3-enyl-4-(3-hydroxyphenyl)-2-oxo-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[1-but-3-enyl-4-(3-hydroxyphenyl)-2-oxo-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 139946757 |
| Molecular Formula | C31H34N4O3 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | 1-[1-but-3-enyl-4-(3-hydroxyphenyl)-2-oxo-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | C=CCCn1c(=O)c(NC(=O)Nc2c(C(C)C)cccc2C(C)C)c(-c2cccc(O)c2)c2cccnc21 |
| InChI | InChI=1S/C31H34N4O3/c1-6-7-17-35-29-25(15-10-16-32-29)26(21-11-8-12-22(36)18-21)28(30(35)37)34-31(38)33-27-23(19(2)3)13-9-14-24(27)20(4)5/h6,8-16,18-20,36H,1,7,17H2,2-5H3,(H2,33,34,38) |
| InChIKey | VEQJCWCOBDKVJL-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|