C38H47N5O2 — CID 22106040
1-[1-butyl-4-[3-[3-(diethylamino)prop-1-ynyl]phenyl]-2-oxo-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 22106040) has the molecular formula C38H47N5O2 and a molecular weight of 605.83 g/mol. Its IUPAC name is 1-[1-butyl-4-[3-[3-(diethylamino)prop-1-ynyl]phenyl]-2-oxo-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[1-butyl-4-[3-[3-(diethylamino)prop-1-ynyl]phenyl]-2-oxo-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 22106040 |
| Molecular Formula | C38H47N5O2 |
| Molecular Weight | 605.83 g/mol |
| Exact Mass | 605.37 |
| IUPAC Name | 1-[1-butyl-4-[3-[3-(diethylamino)prop-1-ynyl]phenyl]-2-oxo-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CCCCn1c(=O)c(NC(=O)Nc2c(C(C)C)cccc2C(C)C)c(-c2cccc(C#CCN(CC)CC)c2)c2cccnc21 |
| InChI | InChI=1S/C38H47N5O2/c1-8-11-24-43-36-32(21-14-22-39-36)33(29-18-12-16-28(25-29)17-15-23-42(9-2)10-3)35(37(43)44)41-38(45)40-34-30(26(4)5)19-13-20-31(34)27(6)7/h12-14,16,18-22,25-27H,8-11,23-24H2,1-7H3,(H2,40,41,45) |
| InChIKey | MEQALSMBNFHOQX-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.83 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|