C35H41N5O2 — CID 22106064
1-[1-butyl-4-[3-[3-(diethylamino)prop-1-ynyl]phenyl]-2-oxo-1,8-naphthyridin-3-yl]-3-(2-propan-2-ylphenyl)urea (PubChem CID 22106064) has the molecular formula C35H41N5O2 and a molecular weight of 563.75 g/mol. Its IUPAC name is 1-[1-butyl-4-[3-[3-(diethylamino)prop-1-ynyl]phenyl]-2-oxo-1,8-naphthyridin-3-yl]-3-(2-propan-2-ylphenyl)urea.
| Compound Name | 1-[1-butyl-4-[3-[3-(diethylamino)prop-1-ynyl]phenyl]-2-oxo-1,8-naphthyridin-3-yl]-3-(2-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 22106064 |
| Molecular Formula | C35H41N5O2 |
| Molecular Weight | 563.75 g/mol |
| Exact Mass | 563.33 |
| IUPAC Name | 1-[1-butyl-4-[3-[3-(diethylamino)prop-1-ynyl]phenyl]-2-oxo-1,8-naphthyridin-3-yl]-3-(2-propan-2-ylphenyl)urea |
| SMILES | CCCCn1c(=O)c(NC(=O)Nc2ccccc2C(C)C)c(-c2cccc(C#CCN(CC)CC)c2)c2cccnc21 |
| InChI | InChI=1S/C35H41N5O2/c1-6-9-23-40-33-29(19-13-21-36-33)31(27-17-12-15-26(24-27)16-14-22-39(7-2)8-3)32(34(40)41)38-35(42)37-30-20-11-10-18-28(30)25(4)5/h10-13,15,17-21,24-25H,6-9,22-23H2,1-5H3,(H2,37,38,42) |
| InChIKey | KEALFHQUZOGAMO-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.75 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|