C39H41N5O3 — CID 22105973
1-[2,6-di(propan-2-yl)phenyl]-3-[2-oxo-1-pent-4-ynyl-4-[3-(2-pyridin-3-ylethoxy)phenyl]-1,8-naphthyridin-3-yl]urea (PubChem CID 22105973) has the molecular formula C39H41N5O3 and a molecular weight of 627.79 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[2-oxo-1-pent-4-ynyl-4-[3-(2-pyridin-3-ylethoxy)phenyl]-1,8-naphthyridin-3-yl]urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[2-oxo-1-pent-4-ynyl-4-[3-(2-pyridin-3-ylethoxy)phenyl]-1,8-naphthyridin-3-yl]urea |
|---|---|
| PubChem CID | 22105973 |
| Molecular Formula | C39H41N5O3 |
| Molecular Weight | 627.79 g/mol |
| Exact Mass | 627.32 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[2-oxo-1-pent-4-ynyl-4-[3-(2-pyridin-3-ylethoxy)phenyl]-1,8-naphthyridin-3-yl]urea |
| SMILES | C#CCCCn1c(=O)c(NC(=O)Nc2c(C(C)C)cccc2C(C)C)c(-c2cccc(OCCc3cccnc3)c2)c2cccnc21 |
| InChI | InChI=1S/C39H41N5O3/c1-6-7-8-22-44-37-33(18-12-21-41-37)34(29-14-9-15-30(24-29)47-23-19-28-13-11-20-40-25-28)36(38(44)45)43-39(46)42-35-31(26(2)3)16-10-17-32(35)27(4)5/h1,9-18,20-21,24-27H,7-8,19,22-23H2,2-5H3,(H2,42,43,46) |
| InChIKey | RXQMLQUXZJOMAI-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.79 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|