C28H31N5O4 — CID 139948279
1-(4-amino-2,6-dimethylphenyl)-3-[1-ethyl-4-[3-(3-hydroxypropoxy)phenyl]-2-oxo-1,8-naphthyridin-3-yl]urea (PubChem CID 139948279) has the molecular formula C28H31N5O4 and a molecular weight of 501.59 g/mol. Its IUPAC name is 1-(4-amino-2,6-dimethylphenyl)-3-[1-ethyl-4-[3-(3-hydroxypropoxy)phenyl]-2-oxo-1,8-naphthyridin-3-yl]urea.
| Compound Name | 1-(4-amino-2,6-dimethylphenyl)-3-[1-ethyl-4-[3-(3-hydroxypropoxy)phenyl]-2-oxo-1,8-naphthyridin-3-yl]urea |
|---|---|
| PubChem CID | 139948279 |
| Molecular Formula | C28H31N5O4 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 1-(4-amino-2,6-dimethylphenyl)-3-[1-ethyl-4-[3-(3-hydroxypropoxy)phenyl]-2-oxo-1,8-naphthyridin-3-yl]urea |
| SMILES | CCn1c(=O)c(NC(=O)Nc2c(C)cc(N)cc2C)c(-c2cccc(OCCCO)c2)c2cccnc21 |
| InChI | InChI=1S/C28H31N5O4/c1-4-33-26-22(10-6-11-30-26)23(19-8-5-9-21(16-19)37-13-7-12-34)25(27(33)35)32-28(36)31-24-17(2)14-20(29)15-18(24)3/h5-6,8-11,14-16,34H,4,7,12-13,29H2,1-3H3,(H2,31,32,36) |
| InChIKey | IYUXBXVERDYDGP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|