C21H24N4O3 — CID 22106230
1-butyl-3-[4-(3-methoxyphenyl)-1-methyl-2-oxo-1,8-naphthyridin-3-yl]urea (PubChem CID 22106230) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 1-butyl-3-[4-(3-methoxyphenyl)-1-methyl-2-oxo-1,8-naphthyridin-3-yl]urea.
| Compound Name | 1-butyl-3-[4-(3-methoxyphenyl)-1-methyl-2-oxo-1,8-naphthyridin-3-yl]urea |
|---|---|
| PubChem CID | 22106230 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-butyl-3-[4-(3-methoxyphenyl)-1-methyl-2-oxo-1,8-naphthyridin-3-yl]urea |
| SMILES | CCCCNC(=O)Nc1c(-c2cccc(OC)c2)c2cccnc2n(C)c1=O |
| InChI | InChI=1S/C21H24N4O3/c1-4-5-11-23-21(27)24-18-17(14-8-6-9-15(13-14)28-3)16-10-7-12-22-19(16)25(2)20(18)26/h6-10,12-13H,4-5,11H2,1-3H3,(H2,23,24,27) |
| InChIKey | PEEJJFCXEDTAQK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|