C35H40N6O3 — CID 70145951
1-[2-tert-butyl-5-(1H-imidazol-2-ylmethyl)phenyl]-3-[4-(3-methoxyphenyl)-2-oxo-1-pentyl-1,8-naphthyridin-3-yl]urea (PubChem CID 70145951) has the molecular formula C35H40N6O3 and a molecular weight of 592.74 g/mol. Its IUPAC name is 1-[2-tert-butyl-5-(1H-imidazol-2-ylmethyl)phenyl]-3-[4-(3-methoxyphenyl)-2-oxo-1-pentyl-1,8-naphthyridin-3-yl]urea.
| Compound Name | 1-[2-tert-butyl-5-(1H-imidazol-2-ylmethyl)phenyl]-3-[4-(3-methoxyphenyl)-2-oxo-1-pentyl-1,8-naphthyridin-3-yl]urea |
|---|---|
| PubChem CID | 70145951 |
| Molecular Formula | C35H40N6O3 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.32 |
| IUPAC Name | 1-[2-tert-butyl-5-(1H-imidazol-2-ylmethyl)phenyl]-3-[4-(3-methoxyphenyl)-2-oxo-1-pentyl-1,8-naphthyridin-3-yl]urea |
| SMILES | CCCCCn1c(=O)c(NC(=O)Nc2cc(Cc3ncc[nH]3)ccc2C(C)(C)C)c(-c2cccc(OC)c2)c2cccnc21 |
| InChI | InChI=1S/C35H40N6O3/c1-6-7-8-19-41-32-26(13-10-16-38-32)30(24-11-9-12-25(22-24)44-5)31(33(41)42)40-34(43)39-28-20-23(21-29-36-17-18-37-29)14-15-27(28)35(2,3)4/h9-18,20,22H,6-8,19,21H2,1-5H3,(H,36,37)(H2,39,40,43) |
| InChIKey | HQWOWAQZTQIQTB-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|