C14H27N3 — CID 174329659
(3aR,6aS)-5-methyl-2-[(4-methylpiperazin-1-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 174329659) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is (3aR,6aS)-5-methyl-2-[(4-methylpiperazin-1-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aR,6aS)-5-methyl-2-[(4-methylpiperazin-1-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 174329659 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | (3aR,6aS)-5-methyl-2-[(4-methylpiperazin-1-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | CC1C[C@@H]2CN(CN3CCN(C)CC3)C[C@@H]2C1 |
| InChI | InChI=1S/C14H27N3/c1-12-7-13-9-17(10-14(13)8-12)11-16-5-3-15(2)4-6-16/h12-14H,3-11H2,1-2H3/t12?,13-,14+ |
| InChIKey | AKEWVWPYWNRGEA-AGUYFDCRSA-N |
| XLogP | 1.17 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |