C23H26BrN3O3 — CID 174335620
N-[(5-bromo-2-phenylmethoxyphenyl)methyl]pyridazin-3-amine;2-methylbutanoic acid (PubChem CID 174335620) has the molecular formula C23H26BrN3O3 and a molecular weight of 472.38 g/mol. Its IUPAC name is N-[(5-bromo-2-phenylmethoxyphenyl)methyl]pyridazin-3-amine;2-methylbutanoic acid.
| Compound Name | N-[(5-bromo-2-phenylmethoxyphenyl)methyl]pyridazin-3-amine;2-methylbutanoic acid |
|---|---|
| PubChem CID | 174335620 |
| Molecular Formula | C23H26BrN3O3 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | N-[(5-bromo-2-phenylmethoxyphenyl)methyl]pyridazin-3-amine;2-methylbutanoic acid |
| SMILES | Brc1ccc(OCc2ccccc2)c(CNc2cccnn2)c1.CCC(C)C(=O)O |
| InChI | InChI=1S/C18H16BrN3O.C5H10O2/c19-16-8-9-17(23-13-14-5-2-1-3-6-14)15(11-16)12-20-18-7-4-10-21-22-18;1-3-4(2)5(6)7/h1-11H,12-13H2,(H,20,22);4H,3H2,1-2H3,(H,6,7) |
| InChIKey | QKLORISDRRKCRK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |