C16H20N2O4S — CID 174337157
2,2-dimethyl-4-(2-oxopiperidin-1-yl)chromene-6-sulfonamide (PubChem CID 174337157) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 2,2-dimethyl-4-(2-oxopiperidin-1-yl)chromene-6-sulfonamide.
| Compound Name | 2,2-dimethyl-4-(2-oxopiperidin-1-yl)chromene-6-sulfonamide |
|---|---|
| PubChem CID | 174337157 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2,2-dimethyl-4-(2-oxopiperidin-1-yl)chromene-6-sulfonamide |
| SMILES | CC1(C)C=C(N2CCCCC2=O)c2cc(S(N)(=O)=O)ccc2O1 |
| InChI | InChI=1S/C16H20N2O4S/c1-16(2)10-13(18-8-4-3-5-15(18)19)12-9-11(23(17,20)21)6-7-14(12)22-16/h6-7,9-10H,3-5,8H2,1-2H3,(H2,17,20,21) |
| InChIKey | ALBLJSMGCQXOIQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |