C17H14N2O2S — CID 22122760
2,2-dimethyl-4-(5-oxo-6-sulfanylidene-2H-pyridin-1-yl)chromene-6-carbonitrile (PubChem CID 22122760) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2,2-dimethyl-4-(5-oxo-6-sulfanylidene-2H-pyridin-1-yl)chromene-6-carbonitrile.
| Compound Name | 2,2-dimethyl-4-(5-oxo-6-sulfanylidene-2H-pyridin-1-yl)chromene-6-carbonitrile |
|---|---|
| PubChem CID | 22122760 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2,2-dimethyl-4-(5-oxo-6-sulfanylidene-2H-pyridin-1-yl)chromene-6-carbonitrile |
| SMILES | CC1(C)C=C(N2CC=CC(=O)C2=S)c2cc(C#N)ccc2O1 |
| InChI | InChI=1S/C17H14N2O2S/c1-17(2)9-13(19-7-3-4-14(20)16(19)22)12-8-11(10-18)5-6-15(12)21-17/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | GMOPDQKWXNWWMZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|